* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016760 |
| English Synonyms: | VITAS-BB TBB016760 |
| MDL Number.: | MFCD00630142 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC1=CC=CC=C1C1NC(=O)NC(C)=C1C(=O)OC1CCCCCCC1 |
| InChi: | InChI=1S/C22H30N2O4/c1-3-27-18-14-10-9-13-17(18)20-19(15(2)23-22(26)24-20)21(25)28-16-11-7-5-4-6-8-12-16/h9-10,13-14,16,20H,3-8,11-12H2,1-2H3,(H2,23,24,26) |
| InChiKey: | InChIKey=WMKHBKQDIADBTG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.