* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035843 |
English Synonyms: | VITAS-BB TBB035843 |
MDL Number.: | MFCD00630152 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CC1=C(C(NC(=O)N1)C1=CC=C(O)C(=C1)[N+]([O-])=O)C(=O)OC1CCCCCCC1 |
InChi: | InChI=1S/C20H25N3O6/c1-12-17(19(25)29-14-7-5-3-2-4-6-8-14)18(22-20(26)21-12)13-9-10-16(24)15(11-13)23(27)28/h9-11,14,18,24H,2-8H2,1H3,(H2,21,22,26) |
InChiKey: | InChIKey=PVZJCGCSLJJQKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.