Molecular Structure:
CCD No.:CCD00146343
ZERENEX E/4039402
Formula:C15 H8 Cl N3 O S2
MolWeight:345.833
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/4039402 |
| English Synonyms： | ZERENEX E/4039402 |
| MDL Number.： | MFCD00631502 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)c(c(s2)C(=O)Nc3cccc4c3nsn4)Cl |
| InChi： | InChI=1S/C15H8ClN3OS2/c16-12-8-4-1-2-7-11(8)21-14(12)15(20)17-9-5-3-6-10-13(9)19-22-18-10/h1-7H,(H,17,20) |
| InChiKey： | InChIKey=PKFNJPFWASDMHE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
