* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB019379 |
| English Synonyms: | VITAS-BB TBB019379 |
| MDL Number.: | MFCD00637135 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCN(CCC)C1=CC=C(\C=N\NC(=O)C2=CC=CC=C2)C=C1 |
| InChi: | InChI=1S/C20H25N3O/c1-3-14-23(15-4-2)19-12-10-17(11-13-19)16-21-22-20(24)18-8-6-5-7-9-18/h5-13,16H,3-4,14-15H2,1-2H3,(H,22,24)/b21-16+ |
| InChiKey: | InChIKey=JVQLFNFNHUKRAL-LTGZKZEYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.