Molecular Structure:
CCD No.:CCD00146626
ZERENEX E/4039388
Formula:C13 H8 F N3 O S
MolWeight:273.29
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/4039388 |
| English Synonyms： | ZERENEX E/4039388 |
| MDL Number.： | MFCD00640582 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1ccc(c(c1)C(=O)Nc2cccc3c2nsn3)F |
| InChi： | InChI=1S/C13H8FN3OS/c14-9-5-2-1-4-8(9)13(18)15-10-6-3-7-11-12(10)17-19-16-11/h1-7H,(H,15,18) |
| InChiKey： | InChIKey=AUUQWDPRUJBBQG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
