* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024563 |
| English Synonyms: | VITAS-BB TBB024563 |
| MDL Number.: | MFCD00640821 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | O=C(N\N=C/C1=CC=CO1)C1=CC=CS1 |
| InChi: | InChI=1S/C10H8N2O2S/c13-10(9-4-2-6-15-9)12-11-7-8-3-1-5-14-8/h1-7H,(H,12,13)/b11-7- |
| InChiKey: | InChIKey=ISTFEGKCGPOOMV-XFFZJAGNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.