Molecular Structure:
CCD No.:CCD00146692
ZERENEX E/1120111
Formula:C13 H19 N3 O3
MolWeight:265.311
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1120111 |
| English Synonyms： | ZERENEX E/1120111 |
| MDL Number.： | MFCD00642666 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | c1cc(c(cc1N2CCCC2)NCCCO)[N+](=O)[O-] |
| InChi： | InChI=1S/C13H19N3O3/c17-9-3-6-14-12-10-11(15-7-1-2-8-15)4-5-13(12)16(18)19/h4-5,10,14,17H,1-3,6-9H2 |
| InChiKey： | InChIKey=BCTKQCQGINTGIP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
