Molecular Structure:
CCD No.:CCD00146708
ZERENEX E/6026453
Formula:C19 H17 Br N2 O2
MolWeight:385.259
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026453 |
| English Synonyms： | ZERENEX E/6026453 |
| MDL Number.： | MFCD00642934 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | COC(=O)C1Cc2c3ccccc3[nH]c2C(N1)c4ccc(cc4)Br |
| InChi： | InChI=1S/C19H17BrN2O2/c1-24-19(23)16-10-14-13-4-2-3-5-15(13)21-18(14)17(22-16)11-6-8-12(20)9-7-11/h2-9,16-17,21-22H,10H2,1H3 |
| InChiKey： | InChIKey=UUKPOUWUKZFGJZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
