* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB019407 |
English Synonyms: | VITAS-BB TBB019407 |
MDL Number.: | MFCD00643922 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1=NN(C(Cl)=C1\C=N\NC(=O)C1=CC=NC=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C17H14ClN5O/c1-12-15(11-20-21-17(24)13-7-9-19-10-8-13)16(18)23(22-12)14-5-3-2-4-6-14/h2-11H,1H3,(H,21,24)/b20-11+ |
InChiKey: | InChIKey=JJHZZORFDQQNOQ-RGVLZGJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.