* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7'-METHYL-5'-NITROSPIRO[1,3-DIOXOLANE-2,3'-INDOL]-2'(1'H)-ONE |
English Synonyms: | 7'-METHYL-5'-NITROSPIRO[1,3-DIOXOLANE-2,3'-INDOL]-2'(1'H)-ONE |
MDL Number.: | MFCD00658640 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1cc(cc2c1NC(=O)C23OCCO3)[N+](=O)[O-] |
InChi: | InChI=1S/C11H10N2O5/c1-6-4-7(13(15)16)5-8-9(6)12-10(14)11(8)17-2-3-18-11/h4-5H,2-3H2,1H3,(H,12,14) |
InChiKey: | InChIKey=IOHLEXKNRQQQQK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.