Molecular Structure:
CCD No.:CCD00147165
ZERENEX E/6022193
Formula:C12 H14 N4 O2 S
MolWeight:278.335
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6022193 |
| English Synonyms： | ZERENEX E/6022193 |
| MDL Number.： | MFCD00658795 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1cc(c(c2c1nsn2)[N+](=O)[O-])NC3CCCCC3 |
| InChi： | InChI=1S/C12H14N4O2S/c17-16(18)12-10(13-8-4-2-1-3-5-8)7-6-9-11(12)15-19-14-9/h6-8,13H,1-5H2 |
| InChiKey： | InChIKey=IOYPUVVYQWISON-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
