Molecular Structure:
CCD No.:CCD00147173
ZERENEX E/6026466
Formula:C21 H19 N3 O
MolWeight:329.401
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026466 |
| English Synonyms： | ZERENEX E/6026466 |
| MDL Number.： | MFCD00658848 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | Cc1ccc(c(c1)NC(=O)c2cc3c4ccccc4[nH]c3c(n2)C)C |
| InChi： | InChI=1S/C21H19N3O/c1-12-8-9-13(2)18(10-12)24-21(25)19-11-16-15-6-4-5-7-17(15)23-20(16)14(3)22-19/h4-11,23H,1-3H3,(H,24,25) |
| InChiKey： | InChIKey=WUQPIACXRPHRQP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
