Molecular Structure:
CCD No.:CCD00147176
ZERENEX E/6026470
Formula:C20 H15 N3 O3
MolWeight:345.357
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026470 |
| English Synonyms： | ZERENEX E/6026470 |
| MDL Number.： | MFCD00658854 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | Cc1c2c(cc(n1)C(=O)Nc3ccccc3C(=O)O)c4ccccc4[nH]2 |
| InChi： | InChI=1S/C20H15N3O3/c1-11-18-14(12-6-2-4-8-15(12)22-18)10-17(21-11)19(24)23-16-9-5-3-7-13(16)20(25)26/h2-10,22H,1H3,(H,23,24)(H,25,26) |
| InChiKey： | InChIKey=JXKKWYPQTJBSEX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
