Molecular Structure:
CCD No.:CCD00147177
ZERENEX E/6026467
Formula:C20 H17 N3 O2
MolWeight:331.373
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026467 |
| English Synonyms： | ZERENEX E/6026467 |
| MDL Number.： | MFCD00658858 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | Cc1c2c(cc(n1)C(=O)Nc3ccc(cc3)OC)c4ccccc4[nH]2 |
| InChi： | InChI=1S/C20H17N3O2/c1-12-19-16(15-5-3-4-6-17(15)23-19)11-18(21-12)20(24)22-13-7-9-14(25-2)10-8-13/h3-11,23H,1-2H3,(H,22,24) |
| InChiKey： | InChIKey=ABSZBDPTIBFIGX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
