Molecular Structure:
CCD No.:CCD00147178
ZERENEX E/6026469
Formula:C20 H14 F3 N3 O
MolWeight:369.345
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026469 |
| English Synonyms： | ZERENEX E/6026469 |
| MDL Number.： | MFCD00658864 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | Cc1c2c(cc(n1)C(=O)Nc3cccc(c3)C(F)(F)F)c4ccccc4[nH]2 |
| InChi： | InChI=1S/C20H14F3N3O/c1-11-18-15(14-7-2-3-8-16(14)26-18)10-17(24-11)19(27)25-13-6-4-5-12(9-13)20(21,22)23/h2-10,26H,1H3,(H,25,27) |
| InChiKey： | InChIKey=ZZUSQQZFNBUFKM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
