Molecular Structure:
CCD No.:CCD00147179
ZERENEX E/6026592
Formula:C25 H14 N4 O
MolWeight:386.413
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026592 |
| English Synonyms： | ZERENEX E/6026592 |
| MDL Number.： | MFCD00658865 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | c1ccc(cc1)c2c3c(c(nn2)c4ccccc4)nc5c(n3)-c6ccccc6C5=O |
| InChi： | InChI=1S/C25H14N4O/c30-25-18-14-8-7-13-17(18)21-24(25)27-23-20(16-11-5-2-6-12-16)29-28-19(22(23)26-21)15-9-3-1-4-10-15/h1-14H |
| InChiKey： | InChIKey=HMTZURFIGXGDMO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
