Molecular Structure:
CCD No.:CCD00147181
ZERENEX E/6026455
Formula:C19 H16 Cl2 N2 O2
MolWeight:375.253
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6026455 |
| English Synonyms： | ZERENEX E/6026455 |
| MDL Number.： | MFCD00658872 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | COC(=O)C1Cc2c3ccccc3[nH]c2C(N1)c4ccc(cc4Cl)Cl |
| InChi： | InChI=1S/C19H16Cl2N2O2/c1-25-19(24)16-9-13-11-4-2-3-5-15(11)22-18(13)17(23-16)12-7-6-10(20)8-14(12)21/h2-8,16-17,22-23H,9H2,1H3 |
| InChiKey： | InChIKey=GRNZPDVXMDBGHG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
