* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOXAZOLO[5,4-B]PYRIDIN-3-OL |
CAS: | 16880-54-9 |
English Synonyms: | ISOXAZOLO[5,4-B]PYRIDIN-3-OL |
MDL Number.: | MFCD00661425 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(noc2nc1)O |
InChi: | InChI=1S/C6H4N2O2/c9-5-4-2-1-3-7-6(4)10-8-5/h1-3H,(H,8,9) |
InChiKey: | InChIKey=VHMSVJIBCHFSKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.