* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BE 1040 |
| English Synonyms: | RARECHEM AL BE 1040 |
| MDL Number.: | MFCD00662922 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)CCc1c(c([nH]c1C(=O)O)C(=O)OCC)CC(=O)OCC |
| InChi: | InChI=1S/C17H23NO8/c1-4-24-12(19)8-7-10-11(9-13(20)25-5-2)15(17(23)26-6-3)18-14(10)16(21)22/h18H,4-9H2,1-3H3,(H,21,22) |
| InChiKey: | InChIKey=VGEOJDVGAUEJBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.