* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLE, [2-14C] |
English Synonyms: | INDOLE, [2-14C] |
MDL Number.: | MFCD00671173 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c[14cH][nH]2 |
InChi: | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/i6+2 |
InChiKey: | InChIKey=SIKJAQJRHWYJAI-ZQBYOMGUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.