Molecular Structure:
CCD No.:CCD00150437
INDOLE, [2-14C]
Formula:C8 H7 N
MolWeight:119.139
![INDOLE, [2-14C] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | INDOLE, [2-14C] |
| English Synonyms： | INDOLE, [2-14C] |
| MDL Number.： | MFCD00671173 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)c[14cH][nH]2 |
| InChi： | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/i6+2 |
| InChiKey： | InChIKey=SIKJAQJRHWYJAI-ZQBYOMGUSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
