* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOPENTENOL, [1-14C] |
English Synonyms: | ISOPENTENOL, [1-14C] |
MDL Number.: | MFCD00671210 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(=C)C[14CH2]O |
InChi: | InChI=1S/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3/i4+2 |
InChiKey: | InChIKey=CPJRRXSHAYUTGL-DOMIDYPGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.