Molecular Structure:
CCD No.:CCD00150518
XANTHINE, [8-3H]
Formula:C5 H3 N4 O2 T
MolWeight:154.121
![XANTHINE, [8-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | XANTHINE, [8-3H] |
| English Synonyms： | XANTHINE, [8-3H] |
| MDL Number.： | MFCD00671270 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | [3H]c1[nH]c2c(n1)[nH]c(=O)[nH]c2=O |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
