Molecular Structure:
CCD No.:CCD00150554
GANCICLOVIR, [8-3H]
Formula:C9 H12 N5 O4 T
MolWeight:257.241
![GANCICLOVIR, [8-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | GANCICLOVIR, [8-3H] |
| English Synonyms： | GANCICLOVIR, [8-3H] |
| MDL Number.： | MFCD00671329 |
| H bond acceptor： | 9 |
| H bond donor： | 4 |
| Smile： | [3H]c1nc2c(n1COC(CO)CO)[nH]c(nc2=O)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
