* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL 5-HEXENOATE |
CAS: | 54653-25-7 |
English Synonyms: | ETHYL HEX-5-ENOATE ; ETHYL 5-HEXENOATE |
MDL Number.: | MFCD00671844 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCOC(=O)CCCC=C |
InChi: | InChI=1S/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h3H,1,4-7H2,2H3 |
InChiKey: | InChIKey=RJLJOXJZWMGEFD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.