* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XANTHINE, SODIUM |
English Synonyms: | XANTHINE, SODIUM |
MDL Number.: | MFCD00672262 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1[nH]c2c(=O)[nH]c(nc2n1)[O-].[Na+] |
InChi: | InChI=1S/C5H4N4O2.Na/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H3,6,7,8,9,10,11);/q;+1/p-1 |
InChiKey: | InChIKey=HKDXLLDCXWUUKY-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.