* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GUANOSINE 5'-TRIPHOSPHATE, [ALPHA-33P]- |
| English Synonyms: | GTP [ALPHA-33P]- ; GUANOSINE 5'-TRIPHOSPHATE, [ALPHA-33P]- |
| MDL Number.: | MFCD00673345 |
| H bond acceptor: | 19 |
| H bond donor: | 8 |
| Smile: | NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO[33P](O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChi: | InChI=1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1/i31+2 |
| InChiKey: | InChIKey=XKMLYUALXHKNFT-QUPSZBINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.