* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | YM617, [PHENOXY-3H]- |
English Synonyms: | YM617, [PHENOXY-3H]- |
MDL Number.: | MFCD00673407 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cl.[3H]C1=C([3H])C(OCC)=C(OCCN[C@H](C)CC2=CC=C(OC)C(=C2)S(N)(=O)=O)C([3H])=C1[3H] |
InChi: | InChI=1S/C20H28N2O5S.ClH/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);1H/t15-;/m1./s1/i5T,6T,7T,8T; |
InChiKey: | InChIKey=ZZIZZTHXZRDOFM-OFJZSZHLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.