* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IPAG |
CAS: | 133985-85-0 |
English Synonyms: | IPAG ; 1-(4-IODOPHENYL)-3-(2-ADAMANTYL)GUANIDINE |
MDL Number.: | MFCD00673882 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(ccc1NC(=N)NC2[C@H]3C[C@@H]4C[C@H](C3)C[C@H]2C4)I |
InChi: | InChI=1S/C17H22IN3/c18-14-1-3-15(4-2-14)20-17(19)21-16-12-6-10-5-11(8-12)9-13(16)7-10/h1-4,10-13,16H,5-9H2,(H3,19,20,21)/t10-,11+,12-,13+,16? |
InChiKey: | InChIKey=UUKPIWYXWLJPJF-KZAAHDRASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.