Molecular Structure:
CCD No.:CCD00152629
7-BROMOBICYCLO[2.2.1]HEPTANE
CAS No.:
13237-88-2
Formula:C7 H11 Br
MolWeight:175.068
![7-BROMOBICYCLO[2.2.1]HEPTANE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(7)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | 7-BROMOBICYCLO[2.2.1]HEPTANE |
| CAS： | 13237-88-2 |
| English Synonyms： | 7-BROMONORBORNANE ; 7-BROMOBICYCLO[2.2.1]HEPTANE |
| MDL Number.： | MFCD00674502 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | C1C[C@@H]2CC[C@H]1C2Br |
| InChi： | InChI=1S/C7H11Br/c8-7-5-1-2-6(7)4-3-5/h5-7H,1-4H2/t5-,6+,7? |
| InChiKey： | InChIKey=WHGPQZJYJWIBGZ-MEKDEQNOSA-N |
|
|
| Boiling Point： | 75 DEG C/20 MMHG(LIT) |
| Density： | DENSITY: 1.38 G/ML AT 20 DEG C(LIT) |
| Physical Property： | REFRACTIVE INDEX: N20/D 1.518 |
| Comments： | UNSPSC: 12352100 WGK: 3 |
| Specification： | TECHNICAL GRADE |
|
|
| Symbol： |
GHS07
|
| Signal word： | Warning |
| Hazard statements： | H315-H319-H335 |
| Precautionary statements： | P261-P305 + P351 + P338 |
| hazard symbol： | Xi |
| Risk Code： | R:36/37/38 |
| Safe Code： | S:26-36 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
