* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1358240 |
| English Synonyms: | OTAVA-BB 1358240 |
| MDL Number.: | MFCD00679861 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(=O)Nc1ccc(cc1)NC(=O)C2C3CC(C2C(=O)O)C=C3 |
| InChi: | InChI=1S/C17H18N2O4/c1-9(20)18-12-4-6-13(7-5-12)19-16(21)14-10-2-3-11(8-10)15(14)17(22)23/h2-7,10-11,14-15H,8H2,1H3,(H,18,20)(H,19,21)(H,22,23) |
| InChiKey: | InChIKey=ZFURNLHIJVEJAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.