Molecular Structure:
CCD No.:CCD00154698
OTAVA-BB 1137336
Formula:C10 H11 N O5 S
MolWeight:257.265
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1137336 |
| English Synonyms： | OTAVA-BB 1137336 |
| MDL Number.： | MFCD00680005 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CC(=O)Nc1ccc(cc1)S(=O)(=O)CC(=O)O |
| InChi： | InChI=1S/C10H11NO5S/c1-7(12)11-8-2-4-9(5-3-8)17(15,16)6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14) |
| InChiKey： | InChIKey=ZGCGYRMPCJJMNJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
