* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1272319 |
| English Synonyms: | OTAVA-BB 1272319 |
| MDL Number.: | MFCD00680096 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | OCCNC(=O)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C16H17NO2/c18-12-11-17-16(19)15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2,(H,17,19) |
| InChiKey: | InChIKey=KRCFJJLFJDBEAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.