Molecular Structure:
CCD No.:CCD00154758
G 1558
CAS No.:
174503-70-9
Formula:C18 H12 Cl2 N2 O S
MolWeight:375.278
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | G 1558 |
| CAS： | 174503-70-9 |
| English Synonyms： | G 1558 |
| MDL Number.： | MFCD00681301 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CSc1[nH]c2cc(c(cc2n1)Cl)Oc3ccc(c4c3cccc4)Cl |
| InChi： | InChI=1S/C18H12Cl2N2OS/c1-24-18-21-14-8-13(20)17(9-15(14)22-18)23-16-7-6-12(19)10-4-2-3-5-11(10)16/h2-9H,1H3,(H,21,22) |
| InChiKey： | InChIKey=OSDDXEWTQZXREV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
