Molecular Structure:
CCD No.:CCD00154765
OTAVA-BB 1137193
Formula:C16 H14 N2 O2
MolWeight:266.299
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1137193 |
| English Synonyms： | OTAVA-BB 1137193 |
| MDL Number.： | MFCD00681374 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)c2nc3ccccc3n2CCC(=O)O |
| InChi： | InChI=1S/C16H14N2O2/c19-15(20)10-11-18-14-9-5-4-8-13(14)17-16(18)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20) |
| InChiKey： | InChIKey=MBBFDTZKXGHZNC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
