* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016575 |
| English Synonyms: | VITAS-BB TBB016575 |
| MDL Number.: | MFCD00687508 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [O-][N+](=O)C1=CC=C(CC(=O)N\N=C\C2=CC=CO2)C=C1 |
| InChi: | InChI=1S/C13H11N3O4/c17-13(15-14-9-12-2-1-7-20-12)8-10-3-5-11(6-4-10)16(18)19/h1-7,9H,8H2,(H,15,17)/b14-9+ |
| InChiKey: | InChIKey=JHVADQUYMNAVRC-NTEUORMPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.