* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024346 |
| English Synonyms: | VITAS-BB TBB024346 |
| MDL Number.: | MFCD00687509 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | O=C(N\N=C\C1=CC=CS1)C1=CC=C(O1)C(=O)N\N=C\C1=CC=CS1 |
| InChi: | InChI=1S/C16H12N4O3S2/c21-15(19-17-9-11-3-1-7-24-11)13-5-6-14(23-13)16(22)20-18-10-12-4-2-8-25-12/h1-10H,(H,19,21)(H,20,22)/b17-9+,18-10+ |
| InChiKey: | InChIKey=SIXSZWRIHKKKNQ-BEQMOXJMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.