* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024348 |
| English Synonyms: | VITAS-BB TBB024348 |
| MDL Number.: | MFCD00687513 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CC1=CC=C(O1)\C=N\NC(=O)C1=CC=C(O1)C(=O)N\N=C\C1=CC=C(C)O1 |
| InChi: | InChI=1S/C18H16N4O5/c1-11-3-5-13(25-11)9-19-21-17(23)15-7-8-16(27-15)18(24)22-20-10-14-6-4-12(2)26-14/h3-10H,1-2H3,(H,21,23)(H,22,24)/b19-9+,20-10+ |
| InChiKey: | InChIKey=QTXFRZMCXQVRMZ-LQGKIZFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.