* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB019160 |
| English Synonyms: | VITAS-BB TBB019160 |
| MDL Number.: | MFCD00687523 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | O=C(N\N=C\C1=CC=CO1)C1=CC=C(C=C1)C(=O)N\N=C\C1=CC=CO1 |
| InChi: | InChI=1S/C18H14N4O4/c23-17(21-19-11-15-3-1-9-25-15)13-5-7-14(8-6-13)18(24)22-20-12-16-4-2-10-26-16/h1-12H,(H,21,23)(H,22,24)/b19-11+,20-12+ |
| InChiKey: | InChIKey=GGFHSXUDDTWSMV-AYKLPDECSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.