* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024706 |
English Synonyms: | VITAS-BB TBB024706 |
MDL Number.: | MFCD00687593 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C\C(=N/NC(=O)C1=CC2=C(OCO2)C=C1)C1=CC=NC=C1 |
InChi: | InChI=1S/C15H13N3O3/c1-10(11-4-6-16-7-5-11)17-18-15(19)12-2-3-13-14(8-12)21-9-20-13/h2-8H,9H2,1H3,(H,18,19)/b17-10+ |
InChiKey: | InChIKey=CMRYQUOVZQEUHI-LICLKQGHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.