* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023184 |
| English Synonyms: | VITAS-BB TBB023184 |
| MDL Number.: | MFCD00687609 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C\C(=N/NC(=O)C1=CC=C(Br)O1)C1=CC=CS1 |
| InChi: | InChI=1S/C11H9BrN2O2S/c1-7(9-3-2-6-17-9)13-14-11(15)8-4-5-10(12)16-8/h2-6H,1H3,(H,14,15)/b13-7+ |
| InChiKey: | InChIKey=YMFXOGHEUXAZOF-NTUHNPAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.