* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 7713580176 |
| English Synonyms: | OTAVA-BB 7713580176 |
| MDL Number.: | MFCD00691967 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC1=CC=C(C=C1)N1CC(=O)C(=C1N)C1=NC2=C(N1)C=CC=C2 |
| InChi: | InChI=1S/C19H18N4O2/c1-2-25-13-9-7-12(8-10-13)23-11-16(24)17(18(23)20)19-21-14-5-3-4-6-15(14)22-19/h3-10H,2,11,20H2,1H3,(H,21,22) |
| InChiKey: | InChIKey=YKJZUANDGXTUGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.