Molecular Structure:
CCD No.:CCD00155682
OTAVA-BB 1659463
Formula:C15 H25 N O2
MolWeight:251.367
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1659463 |
| English Synonyms： | OTAVA-BB 1659463 |
| MDL Number.： | MFCD00698247 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CCCCOc1ccc(cc1)C(CCN(C)C)O |
| InChi： | InChI=1S/C15H25NO2/c1-4-5-12-18-14-8-6-13(7-9-14)15(17)10-11-16(2)3/h6-9,15,17H,4-5,10-12H2,1-3H3 |
| InChiKey： | InChIKey=HDGUOJJCKLEEQE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
