Molecular Structure:
CCD No.:CCD00155686
OTAVA-BB 1797890
Formula:C14 H28 N2
MolWeight:224.389
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1797890 |
| English Synonyms： | OTAVA-BB 1797890 |
| MDL Number.： | MFCD00698261 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | C1CCCN(CC1)CCN2CCCCCC2 |
| InChi： | InChI=1S/C14H28N2/c1-2-6-10-15(9-5-1)13-14-16-11-7-3-4-8-12-16/h1-14H2 |
| InChiKey： | InChIKey=LROMTUZQVQWPDI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
