Molecular Structure:
CCD No.:CCD00155722
OTAVA-BB 1506916
Formula:C16 H23 N O3
MolWeight:277.362
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1506916 |
| English Synonyms： | OTAVA-BB 1506916 |
| MDL Number.： | MFCD00699129 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | CC(C)COc1ccc(cc1)C(=O)CN2CCOCC2 |
| InChi： | InChI=1S/C16H23NO3/c1-13(2)12-20-15-5-3-14(4-6-15)16(18)11-17-7-9-19-10-8-17/h3-6,13H,7-12H2,1-2H3 |
| InChiKey： | InChIKey=PGHLSOQPCNMERF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
