Molecular Structure:
CCD No.:CCD00155740
OTAVA-BB 1506911
Formula:C17 H25 N O2
MolWeight:275.389
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1506911 |
| English Synonyms： | OTAVA-BB 1506911 |
| MDL Number.： | MFCD00699359 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | CC(C)COc1ccc(cc1)C(=O)CCN2CCCC2 |
| InChi： | InChI=1S/C17H25NO2/c1-14(2)13-20-16-7-5-15(6-8-16)17(19)9-12-18-10-3-4-11-18/h5-8,14H,3-4,9-13H2,1-2H3 |
| InChiKey： | InChIKey=RTWIVHMPLCPUBE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
