* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 0112120204 |
| English Synonyms: | OTAVA-BB 0112120204 |
| MDL Number.: | MFCD00703716 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | OC(=O)CN1C(=S)S\C(=C/C2=CC=CC=C2O)C1=O |
| InChi: | InChI=1S/C12H9NO4S2/c14-8-4-2-1-3-7(8)5-9-11(17)13(6-10(15)16)12(18)19-9/h1-5,14H,6H2,(H,15,16)/b9-5- |
| InChiKey: | InChIKey=LCHVZYXQUJKPGJ-UITAMQMPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.