Molecular Structure:
CCD No.:CCD00156007
OTAVA-BB 1174523
Formula:C14 H11 N3 O S
MolWeight:269.327
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1174523 |
| English Synonyms： | OTAVA-BB 1174523 |
| MDL Number.： | MFCD00703879 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc(cnc1)c2[nH]c(=O)c3c4c(sc3n2)CCC4 |
| InChi： | InChI=1S/C14H11N3OS/c18-13-11-9-4-1-5-10(9)19-14(11)17-12(16-13)8-3-2-6-15-7-8/h2-3,6-7H,1,4-5H2,(H,16,17,18) |
| InChiKey： | InChIKey=HOFSBGAZQNYQEQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
