* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1219468 |
| English Synonyms: | OTAVA-BB 1219468 |
| MDL Number.: | MFCD00704765 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | OCCCN1C(=S)S\C(=C/C2=CC=C(Cl)C=C2)C1=O |
| InChi: | InChI=1S/C13H12ClNO2S2/c14-10-4-2-9(3-5-10)8-11-12(17)15(6-1-7-16)13(18)19-11/h2-5,8,16H,1,6-7H2/b11-8- |
| InChiKey: | InChIKey=OFFRYFUHFNUTMC-FLIBITNWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.