Molecular Structure:
CCD No.:CCD00156544
OTAVA-BB 1045523
Formula:C10 H10 Br N O3
MolWeight:272.097
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1045523 |
| English Synonyms： | OTAVA-BB 1045523 |
| MDL Number.： | MFCD00706948 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CC(C(=O)O)NC(=O)c1ccccc1Br |
| InChi： | InChI=1S/C10H10BrNO3/c1-6(10(14)15)12-9(13)7-4-2-3-5-8(7)11/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChiKey： | InChIKey=PJRAZFUHADGGMZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
