* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL 2-((3,5-DIOXO-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZIN-6-YL)THIO)BUTANOATE |
English Synonyms: | ETHYL 2-((3,5-DIOXO-2,3,4,5-TETRAHYDRO-1,2,4-TRIAZIN-6-YL)THIO)BUTANOATE |
MDL Number.: | MFCD00707781 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCC(C(=O)OCC)Sc1c(=O)[nH]c(=O)[nH]n1 |
InChi: | InChI=1S/C9H13N3O4S/c1-3-5(8(14)16-4-2)17-7-6(13)10-9(15)12-11-7/h5H,3-4H2,1-2H3,(H2,10,12,13,15) |
InChiKey: | InChIKey=OILCTGFEQACZJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.